EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O14 |
| Net Charge | 0 |
| Average Mass | 506.457 |
| Monoisotopic Mass | 506.16356 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC[C@H]1O[C@@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H30O14/c22-6-12(25)16(28)17(29)13(26)7-34-21-20(32)19(31)18(30)14(35-21)8-33-15(27)4-2-9-1-3-10(23)11(24)5-9/h1-5,12-14,16-26,28-32H,6-8H2/b4-2+/t12-,13-,14-,16-,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | NKNIPRJKUBSJDO-BCCHJPKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Veronica lavaudiana (ncbitaxon:124267) | - | PubMed (21568305) | MeOH extract of plant material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hebitol II (CHEBI:69792) has role metabolite (CHEBI:25212) |
| hebitol II (CHEBI:69792) is a O-acyl carbohydrate (CHEBI:52782) |
| Citations |
|---|