EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36O8 |
| Net Charge | 0 |
| Average Mass | 548.632 |
| Monoisotopic Mass | 548.24102 |
| SMILES | [H][C@@]12C[C@]1([H])C1=C3C=C(C(=O)[C@H](O)[C@]32C)[C@](C)(C(=O)OC)CC2=C3C=C(C(=O)[C@H](O)[C@@]3(C)[C@]3([H])C[C@]23[H])[C@](C)(C(=O)OC)C1 |
| InChI | InChI=1S/C32H36O8/c1-29(27(37)39-5)11-15-13-7-17(13)32(4)20(15)10-22(24(34)26(32)36)30(2,28(38)40-6)12-16-14-8-18(14)31(3)19(16)9-21(29)23(33)25(31)35/h9-10,13-14,17-18,25-26,35-36H,7-8,11-12H2,1-6H3/t13-,14-,17-,18-,25+,26+,29-,30-,31+,32+/m1/s1 |
| InChIKey | YSPXFYFVBVEVBW-WCQVQBNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21650224) | Methanolic extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloshizukaol A (CHEBI:69788) has role metabolite (CHEBI:25212) |
| cycloshizukaol A (CHEBI:69788) is a diester (CHEBI:51307) |
| Citations |
|---|