EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38O9 |
| Net Charge | 0 |
| Average Mass | 578.658 |
| Monoisotopic Mass | 578.25158 |
| SMILES | [H][C@@]12C[C@]1([H])C1=C3[C@@]2(C)[C@@H](O)C(=O)/C(=C(/C)C(=O)OC)[C@]3([H])[C@]23OC(=O)C(CO)=C2C[C@@]2([H])[C@H](COC(C)=O)[C@@]4([H])C[C@@]4([H])[C@]2(C)[C@]3([H])C1 |
| InChI | InChI=1S/C33H38O9/c1-12(29(38)40-5)24-26-25-16(14-6-20(14)32(25,4)28(37)27(24)36)8-23-31(3)19-7-15(19)18(11-41-13(2)35)21(31)9-22-17(10-34)30(39)42-33(22,23)26/h14-15,18-21,23,26,28,34,37H,6-11H2,1-5H3/b24-12-/t14-,15-,18-,19-,20-,21+,23+,26+,28+,31+,32+,33+/m1/s1 |
| InChIKey | UEHIWILSQZCXQY-LWKKLXHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21650224) | Methanolic extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shizukaol D (CHEBI:69785) has role metabolite (CHEBI:25212) |
| shizukaol D (CHEBI:69785) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|