EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H34O6 |
| Net Charge | 0 |
| Average Mass | 502.607 |
| Monoisotopic Mass | 502.23554 |
| SMILES | [H][C@@]12C[C@]1([H])C1=C3[C@@]2(C)[C@@H](O)C(=O)/C(=C(/C)C(=O)OC)[C@]3([H])[C@]23OC(=O)C(C)=C2C[C@@]2([H])C(=C)[C@]4([H])C[C@]4([H])[C@]2(C)[C@]3([H])C1 |
| InChI | InChI=1S/C31H34O6/c1-11-14-7-19(14)29(4)17(11)10-18-12(2)28(35)37-31(18)21(29)9-16-15-8-20(15)30(5)23(16)24(31)22(25(32)26(30)33)13(3)27(34)36-6/h14-15,17,19-21,24,26,33H,1,7-10H2,2-6H3/b22-13-/t14-,15+,17-,19-,20+,21-,24-,26-,29+,30-,31-/m0/s1 |
| InChIKey | GQSUZVYXPAKHQW-DMAWVQMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21650224) | Methanolic extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shizukaol A (CHEBI:69782) has role metabolite (CHEBI:25212) |
| shizukaol A (CHEBI:69782) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|