EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H42O12 |
| Net Charge | 0 |
| Average Mass | 666.720 |
| Monoisotopic Mass | 666.26763 |
| SMILES | [H][C@]12C[C@@]1([H])[C@@]1(C)[C@@]([H])(CC3=C(CO)C(=O)O[C@@]34C3=C5[C@@](C)([C@@H](O)C(=O)/C3=C(/C)C(=O)OC)[C@]3([H])C[C@]3([H])[C@@]5(OO)C[C@]41[H])[C@]2(O)COC(=O)/C(C)=C/C |
| InChI | InChI=1S/C36H42O12/c1-7-14(2)29(40)46-13-34(43)20-8-18(20)32(4)22(34)10-17-16(12-37)31(42)47-36(17)23(32)11-35(48-44)21-9-19(21)33(5)27(35)25(36)24(26(38)28(33)39)15(3)30(41)45-6/h7,18-23,28,37,39,43-44H,8-13H2,1-6H3/b14-7+,24-15-/t18-,19-,20+,21+,22-,23+,28+,32+,33+,34+,35+,36+/m1/s1 |
| InChIKey | UCIMZKYTYXUXCC-YJTVKYOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21650224) | Methanolic extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorajaponilide E, (rel)- (CHEBI:69781) has role metabolite (CHEBI:25212) |
| chlorajaponilide E, (rel)- (CHEBI:69781) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|