EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H42O14 |
| Net Charge | 0 |
| Average Mass | 746.762 |
| Monoisotopic Mass | 746.25746 |
| SMILES | [H][C@@]12C[C@]1([H])[C@@]1(O)C[C@]3([H])[C@]4(OC(=O)C5=C4C[C@@]4([H])[C@](O)(COC(=O)/C(C)=C/COC(=O)CCC(=O)OC5)[C@@]5([H])C[C@@]5([H])[C@@]43C)C3=C1[C@@]2(C)C(=O)[C@@]1(OC)OC(=O)C(C)=C31 |
| InChI | InChI=1S/C40H42O14/c1-16-8-9-50-26(41)6-7-27(42)51-14-18-19-12-24-35(3,20-10-23(20)38(24,48)15-52-31(16)43)25-13-37(47)22-11-21(22)36(4)30(37)29(39(19,25)53-33(18)45)28-17(2)32(44)54-40(28,49-5)34(36)46/h8,20-25,47-48H,6-7,9-15H2,1-5H3/b16-8+/t20-,21-,22+,23+,24-,25+,35+,36+,37+,38+,39+,40+/m1/s1 |
| InChIKey | ZXVHWWCHBUYLGD-AGMOAELYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21650224) | Methanolic extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorajaponilide D (CHEBI:69780) has role metabolite (CHEBI:25212) |
| chlorajaponilide D (CHEBI:69780) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|