EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H48O14 |
| Net Charge | 0 |
| Average Mass | 764.821 |
| Monoisotopic Mass | 764.30441 |
| SMILES | [H][C@]12C[C@@]1([H])[C@@]1(C)[C@@]([H])(CC3=C(COC(=O)CCC(=O)OC)C(=O)O[C@]34[C@@]1([H])CC1=C3[C@@](C)([C@@H](O)C(=O)/C(=C(/C)C(=O)OC)[C@@]34[H])[C@]3([H])C[C@]13[H])[C@]2(O)COC(=O)/C=C(\C)CO |
| InChI | InChI=1S/C41H48O14/c1-17(14-42)9-30(45)54-16-40(50)25-12-24(25)38(3)26(40)13-23-21(15-53-29(44)8-7-28(43)51-5)37(49)55-41(23)27(38)11-20-19-10-22(19)39(4)32(20)33(41)31(34(46)35(39)47)18(2)36(48)52-6/h9,19,22,24-27,33,35,42,47,50H,7-8,10-16H2,1-6H3/b17-9+,31-18-/t19-,22-,24-,25+,26-,27+,33+,35+,38+,39+,40+,41+/m1/s1 |
| InChIKey | BZYXGNOWZQQMDJ-JGJIUCFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | PubMed (21650224) | Methanolic extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorajaponilide C (CHEBI:69779) has role metabolite (CHEBI:25212) |
| chlorajaponilide C (CHEBI:69779) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|