EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O3 |
| Net Charge | 0 |
| Average Mass | 196.246 |
| Monoisotopic Mass | 196.10994 |
| SMILES | CC1(C)C[C@H](O)C[C@@]2(C)OC(=O)C=C12 |
| InChI | InChI=1S/C11H16O3/c1-10(2)5-7(12)6-11(3)8(10)4-9(13)14-11/h4,7,12H,5-6H2,1-3H3/t7-,11+/m0/s1 |
| InChIKey | XEVQXKKKAVVSMW-WRWORJQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loliolide (CHEBI:69774) has role metabolite (CHEBI:25212) |
| loliolide (CHEBI:69774) is a benzofurans (CHEBI:35259) |
| Synonym | Source |
|---|---|
| (6S,7aR)-6-hydroxy-4,4,7a-trimethyl-6,7-dihydro-5H-1-benzofuran-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:5989-02-6 | ChemIDplus |
| Citations |
|---|