EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O5 |
| Net Charge | 0 |
| Average Mass | 292.291 |
| Monoisotopic Mass | 292.10592 |
| SMILES | O=C(OCC1=CCO[C@H]1N1C(=O)CC[C@@H]1O)c1cccn1 |
| InChI | InChI=1S/C14H16N2O5/c17-11-3-4-12(18)16(11)13-9(5-7-20-13)8-21-14(19)10-2-1-6-15-10/h1-2,5-6,11,13,15,17H,3-4,7-8H2/t11-,13+/m0/s1 |
| InChIKey | DBJBAGUZUMGDCA-WCQYABFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brachystemidine D (CHEBI:69773) has role metabolite (CHEBI:25212) |
| brachystemidine D (CHEBI:69773) is a pyrroles (CHEBI:26455) |
| Synonym | Source |
|---|---|
| [(2R)-2-[(2S)-2-hydroxy-5-oxopyrrolidin-1-yl]-2,5-dihydrofuran-3-yl]methyl 1H-pyrrole-2-carboxylate | ChEBI |
| Citations |
|---|