EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O5 |
| Net Charge | 0 |
| Average Mass | 306.318 |
| Monoisotopic Mass | 306.12157 |
| SMILES | COC1CCC(=O)N1[C@@H]1C=C(COC(=O)c2cccn2)CO1 |
| InChI | InChI=1S/C15H18N2O5/c1-20-13-5-4-12(18)17(13)14-7-10(8-21-14)9-22-15(19)11-3-2-6-16-11/h2-3,6-7,13-14,16H,4-5,8-9H2,1H3/t13?,14-/m0/s1 |
| InChIKey | BPMLAWBYBLOCCU-KZUDCZAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brachystemidine A (CHEBI:69771) has role metabolite (CHEBI:25212) |
| brachystemidine A (CHEBI:69771) is a pyrroles (CHEBI:26455) |
| Synonym | Source |
|---|---|
| 1H-pyrrole-2-carboxylic acid, [(5S)-2,5-dihydro-5-(2-methoxy-5-oxo-1-pyrrolidinyl)-3-furanyl]methyl ester | ChEBI |
| Citations |
|---|