EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H56N8O10 |
| Net Charge | 0 |
| Average Mass | 796.923 |
| Monoisotopic Mass | 796.41194 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccc(O)cc2)C(=O)NC(=O)[C@H](C)NC(=O)[C@H](C)C(=O)N[C@H](C(C)C)NC(=O)CNC1=O |
| InChI | InChI=1S/C39H56N8O10/c1-7-21(4)30-37(55)40-19-29(49)42-31(20(2)3)44-33(51)22(5)32(50)41-23(6)34(52)45-35(53)26(18-24-12-14-25(48)15-13-24)38(56)47-17-9-11-28(47)39(57)46-16-8-10-27(46)36(54)43-30/h12-15,20-23,26-28,30-31,48H,7-11,16-19H2,1-6H3,(H,40,55)(H,41,50)(H,42,49)(H,43,54)(H,44,51)(H,45,52,53)/t21-,22-,23-,26-,27-,28-,30-,31+/m0/s1 |
| InChIKey | SFXXAIZBHQSEFS-JPASZYGRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brachystemin C (CHEBI:69769) has role metabolite (CHEBI:25212) |
| brachystemin C (CHEBI:69769) is a peptide (CHEBI:16670) |
| Citations |
|---|