EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H54N8O10 |
| Net Charge | 0 |
| Average Mass | 782.896 |
| Monoisotopic Mass | 782.39629 |
| SMILES | CC(C)C[C@@H]1NC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccccc2)C(=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](C)C(=O)N1 |
| InChI | InChI=1S/C38H54N8O10/c1-20(2)17-28-41-29(48)19-39-33(51)22(4)40-35(53)26-13-9-15-45(26)38(56)27-14-10-16-46(27)37(55)25(18-24-11-7-6-8-12-24)34(52)44-36(54)30(23(5)47)43-32(50)21(3)31(49)42-28/h6-8,11-12,20-23,25-28,30,47H,9-10,13-19H2,1-5H3,(H,39,51)(H,40,53)(H,41,48)(H,42,49)(H,43,50)(H,44,52,54)/t21-,22+,23-,25-,26+,27+,28-,30+/m1/s1 |
| InChIKey | NFDQDZSUTPQHRB-HAANWHGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-Cyclo-(Pro-Pro-Ala-Gly-Leu-Ala-Thr-Phe) (CHEBI:69768) has role metabolite (CHEBI:25212) |
| rel-Cyclo-(Pro-Pro-Ala-Gly-Leu-Ala-Thr-Phe) (CHEBI:69768) is a peptide (CHEBI:16670) |
| Citations |
|---|