EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H55N9O10 |
| Net Charge | 0 |
| Average Mass | 857.966 |
| Monoisotopic Mass | 857.40719 |
| SMILES | C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2cnc3ccccc23)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)CNC1=O |
| InChI | InChI=1S/C43H55N9O10/c1-23-37(56)45-22-34(55)47-30(19-26-11-5-4-6-12-26)38(57)49-36(25(3)54)41(60)50-35(24(2)53)40(59)48-31(20-27-21-44-29-14-8-7-13-28(27)29)42(61)52-18-10-16-33(52)43(62)51-17-9-15-32(51)39(58)46-23/h4-8,11-14,21,23-25,30-33,35-36,44,53-54H,9-10,15-20,22H2,1-3H3,(H,45,56)(H,46,58)(H,47,55)(H,48,59)(H,49,57)(H,50,60)/t23-,24+,25+,30-,31-,32-,33-,35-,36-/m0/s1 |
| InChIKey | JGNCXUUTDZRSDW-HPAXBWHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brachystemma calycinum (IPNI:151926-1) | aerial part (BTO:0001658) | PubMed (21634415) | 95% aqueous ethanolic extract of sun-dreid and powdered aerial parts |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brachystemin G (CHEBI:69765) has role metabolite (CHEBI:25212) |
| Brachystemin G (CHEBI:69765) is a cyclic peptide (CHEBI:23449) |
| Synonym | Source |
|---|---|
| cyclo(Pro-Pro-Ala-Gly-Phe-Thr-Thr-Trp) | ChEBI |
| Citations |
|---|