EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H47NO18 |
| Net Charge | 0 |
| Average Mass | 805.783 |
| Monoisotopic Mass | 805.27931 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34O[C@@]1(C)COC(=O)c1cccnc1[C@@H](C)[C@H](C)C(=O)O[C@@]([H])([C@H](OC(C)=O)[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@]4(C)O |
| InChI | InChI=1S/C38H47NO18/c1-16-17(2)33(46)56-30-28(52-20(5)42)32(55-23(8)45)37(15-49-18(3)40)31(54-22(7)44)27(51-19(4)41)25-29(53-21(6)43)38(37,36(30,10)48)57-35(25,9)14-50-34(47)24-12-11-13-39-26(16)24/h11-13,16-17,25,27-32,48H,14-15H2,1-10H3/t16-,17-,25+,27+,28-,29+,30-,31+,32-,35-,36-,37-,38-/m0/s1 |
| InChIKey | PBFGAFDJVQAMRS-MNPNNVDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maytenus mekongensis (ncbitaxon:123430) | root (BTO:0001188) | PubMed (21634414) | Methylene dichloride fraction of extract of Dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euonymine (CHEBI:69763) has role metabolite (CHEBI:25212) |
| Euonymine (CHEBI:69763) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (1S,3R,13S,14S,17S,18R,19R,20R,21S,22R,23R,24R,25R)-20-(Acetoxymethyl)-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.0[1,20].0[3,23].0[7,12]]pentacosa-7,9,11-trien e-18,19,21,22,24-pentayl pentaacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:33458-82-1 | ChemIDplus |
| Citations |
|---|