EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H49NO18 |
| Net Charge | 0 |
| Average Mass | 867.854 |
| Monoisotopic Mass | 867.29496 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34O[C@@]1(C)COC(=O)c1cccnc1[C@@H](C)[C@H](C)C(=O)O[C@@]([H])([C@H](OC(C)=O)[C@H](OC(=O)c1ccccc1)[C@]3(COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@]4(C)O |
| InChI | InChI=1S/C43H49NO18/c1-20-21(2)37(50)60-34-32(57-24(5)47)36(61-38(51)27-14-11-10-12-15-27)42(19-54-22(3)45)35(59-26(7)49)31(56-23(4)46)29-33(58-25(6)48)43(42,41(34,9)53)62-40(29,8)18-55-39(52)28-16-13-17-44-30(20)28/h10-17,20-21,29,31-36,53H,18-19H2,1-9H3/t20-,21-,29+,31+,32-,33+,34-,35+,36-,40-,41-,42-,43-/m0/s1 |
| InChIKey | PPRQMPUDIUVHQX-HHGVMSQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maytenus mekongensis (ncbitaxon:123430) | root (BTO:0001188) | PubMed (21634414) | Methylene dichloride fraction of extract of Dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mayteine (CHEBI:69761) has role metabolite (CHEBI:25212) |
| Mayteine (CHEBI:69761) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (1S,3R,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,21,22,24-tetrakis(acetyloxy)-20-[(acetyloxy)methyl]-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.0[1,20].0[3,23].0[7,12]]pentacosa-7,9,11-trien-19-yl benzoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:104736-05-2 | ChemIDplus |
| Citations |
|---|