EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H47NO17 |
| Net Charge | 0 |
| Average Mass | 825.817 |
| Monoisotopic Mass | 825.28440 |
| SMILES | [H][C@]12[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@]3(COC(C)=O)[C@@H](OC(=O)c4ccccc4)[C@@H](OC(C)=O)[C@]4([H])OC(=O)[C@@H](C)[C@H](C)c5ncccc5C(=O)OC[C@]1(C)O[C@@]3([C@@H]2O)[C@@]4(C)O |
| InChI | InChI=1S/C41H47NO17/c1-19-20(2)35(48)57-32-30(55-23(5)45)34(58-36(49)25-13-10-9-11-14-25)40(18-52-21(3)43)33(56-24(6)46)29(54-22(4)44)27-31(47)41(40,39(32,8)51)59-38(27,7)17-53-37(50)26-15-12-16-42-28(19)26/h9-16,19-20,27,29-34,47,51H,17-18H2,1-8H3/t19-,20-,27+,29-,30-,31+,32-,33+,34-,38-,39-,40-,41-/m0/s1 |
| InChIKey | CYMKPLHGMJGZSE-KRYPMMQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maytenus mekongensis (ncbitaxon:123430) | root (BTO:0001188) | PubMed (21634414) | Methylene dichloride fraction of extract of Dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epi-euojaponine A (CHEBI:69757) has role metabolite (CHEBI:25212) |
| 7-epi-euojaponine A (CHEBI:69757) is a terpene lactone (CHEBI:37668) |
| Citations |
|---|