EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H49NO18 |
| Net Charge | 0 |
| Average Mass | 867.854 |
| Monoisotopic Mass | 867.29496 |
| SMILES | [H][C@@]12[C@@H](OC(=O)c3ccccc3)[C@@]34O[C@@]1(C)COC(=O)c1cccnc1CC[C@H](C)C(=O)O[C@@]([H])([C@H](OC(C)=O)[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@]4(C)O |
| InChI | InChI=1S/C43H49NO18/c1-21-16-17-29-28(15-12-18-44-29)39(52)55-19-40(7)30-31(56-23(3)46)35(58-25(5)48)42(20-54-22(2)45)36(59-26(6)49)32(57-24(4)47)34(61-37(21)50)41(8,53)43(42,62-40)33(30)60-38(51)27-13-10-9-11-14-27/h9-15,18,21,30-36,53H,16-17,19-20H2,1-8H3/t21-,30+,31+,32-,33+,34-,35+,36-,40-,41-,42-,43-/m0/s1 |
| InChIKey | VRFBNEKYXLBEOW-SOSGQWQHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maytenus mekongensis (ncbitaxon:123430) | root (BTO:0001188) | PubMed (21634414) | Methylene dichloride fraction of extract of Dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9'-Deacetoxymekongensine (CHEBI:69755) has role metabolite (CHEBI:25212) |
| 9'-Deacetoxymekongensine (CHEBI:69755) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (1S,3R,15S,18S,19R,20R,21S,22S,23R,24R,25R,26S)-19,20,22,23-Tetraacetoxy-21-(acetoxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexaco sa-7,9,11-trien-25-yl benzoate | ChEBI |
| Citations |
|---|