EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H51NO20 |
| Net Charge | 0 |
| Average Mass | 925.890 |
| Monoisotopic Mass | 925.30044 |
| SMILES | [H][C@@]12[C@@H](OC(=O)c3ccccc3)[C@@]34O[C@@]1(C)COC(=O)c1cccnc1CC[C@](C)(OC(C)=O)C(=O)O[C@@]([H])([C@H](OC(C)=O)[C@H](OC(C)=O)[C@]3(COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@]4(C)O |
| InChI | InChI=1S/C45H51NO20/c1-22(47)57-21-44-36(61-25(4)50)32(59-23(2)48)31-34(63-38(53)28-14-11-10-12-15-28)45(44)43(9,56)35(33(60-24(3)49)37(44)62-26(5)51)64-40(55)41(7,65-27(6)52)18-17-30-29(16-13-19-46-30)39(54)58-20-42(31,8)66-45/h10-16,19,31-37,56H,17-18,20-21H2,1-9H3/t31-,32-,33+,34-,35+,36-,37+,41+,42+,43+,44+,45+/m1/s1 |
| InChIKey | ZOOHSIOMIRBBDY-DLKMHDBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maytenus mekongensis (ncbitaxon:123430) | root (BTO:0001188) | PubMed (21634414) | Methylene dichloride fraction of extract of Dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mekongensine (CHEBI:69752) has role metabolite (CHEBI:25212) |
| mekongensine (CHEBI:69752) is a terpene lactone (CHEBI:37668) |
| Synonyms | Source |
|---|---|
| 2,9'-di-O-acetyl-5-O-benzoyl-5-deacetylwilforidine | ChEBI |
| (1S,3R,15S,18S,19R,20R,21S,22S,23R,24R,25R,26S)-15,19,20,22,23-Pentaacetoxy-21-(acetoxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.0[1,21].0[3,24].0[7,12]]hex acosa-7,9,11-trien-25-yl benzoate | ChEBI |
| Citations |
|---|