EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5.H2O |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC(C)=CCc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O.[H]O[H] |
| InChI | InChI=1S/C20H18O5.H2O/c1-11(2)3-4-13-7-12(5-6-16(13)22)15-10-25-18-9-14(21)8-17(23)19(18)20(15)24;/h3,5-10,21-23H,4H2,1-2H3;1H2 |
| InChIKey | WFALQMZTKNBBMO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isowighteone hydrate (CHEBI:69750) has role metabolite (CHEBI:25212) |
| isowighteone hydrate (CHEBI:69750) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| 5,7-dihydroxy-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one hydrate | ChEBI |
| Citations |
|---|