EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CC(C)=CCc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| InChI | InChI=1S/C20H18O5/c1-11(2)3-4-13-7-12(5-6-16(13)22)15-10-25-18-9-14(21)8-17(23)19(18)20(15)24/h3,5-10,21-23H,4H2,1-2H3 |
| InChIKey | SWDSVBNAMCDHTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isowighteone (CHEBI:69749) has functional parent isoflavone (CHEBI:18220) |
| isowighteone (CHEBI:69749) has role plant metabolite (CHEBI:76924) |
| isowighteone (CHEBI:69749) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3'-prenyl-5,7,4'-trihydroxyisoflavone | ChEBI |
| 3'-isoprenylgenistein | ChEBI |
| 5,7,4'-trihydroxy-3'-prenylisoflavone | LIPID MAPS |
| 3'-(γ,γ-dimethylallyl)genistein | HMDB |
| Manual Xrefs | Databases |
|---|---|
| LMPK12050192 | LIPID MAPS |
| HMDB0037920 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1660491 | Reaxys |
| Citations |
|---|