EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O5 |
| Net Charge | 0 |
| Average Mass | 336.343 |
| Monoisotopic Mass | 336.09977 |
| SMILES | CC1(C)C=Cc2cc(-c3coc4cc(O)cc(O)c4c3=O)ccc2O1 |
| InChI | InChI=1S/C20H16O5/c1-20(2)6-5-12-7-11(3-4-16(12)25-20)14-10-24-17-9-13(21)8-15(22)18(17)19(14)23/h3-10,21-22H,1-2H3 |
| InChIKey | WTNXJYOYGPGIJK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoderrone (CHEBI:69748) has functional parent isoflavone (CHEBI:18220) |
| isoderrone (CHEBI:69748) has role plant metabolite (CHEBI:76924) |
| isoderrone (CHEBI:69748) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2',2'-dimethyl-2'H,4H-[3,6'-bi-1-benzopyran]-4-one |
| Synonyms | Source |
|---|---|
| 3-(2,2-dimethylchromen-7-yl)-5,7-dihydroxychromen-4-one | ChEBI |
| 5,7-dihydroxy-6'',6''-dimethylpyrano[2'',3'':4',3']isoflavone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12050207 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4331090 | Reaxys |
| Citations |
|---|