EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H54O7 |
| Net Charge | 0 |
| Average Mass | 634.854 |
| Monoisotopic Mass | 634.38695 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(=O)/C=C/c3ccc(O)cc3)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C39H54O7/c1-23-16-19-39(33(43)44)21-20-36(5)26(31(39)38(23,7)45)13-14-29-35(4)22-27(41)32(34(2,3)28(35)17-18-37(29,36)6)46-30(42)15-10-24-8-11-25(40)12-9-24/h8-13,15,23,27-29,31-32,40-41,45H,14,16-22H2,1-7H3,(H,43,44)/b15-10+/t23-,27-,28+,29-,31-,32+,35+,36-,37-,38-,39+/m1/s1 |
| InChIKey | BZORLJPADUHVJE-QWBBESJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-trans-p-coumaroyltormentic acid (CHEBI:69745) has role metabolite (CHEBI:25212) |
| 3-O-trans-p-coumaroyltormentic acid (CHEBI:69745) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| (2alpha,3beta)-2,19-Dihydroxy-3-{[(2E)-3-(4-hydroxyphenyl)-2-propenoyl]oxy}urs-12-en-28-oic acid | ChEBI |
| Citations |
|---|