EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O2 |
| Net Charge | 0 |
| Average Mass | 468.766 |
| Monoisotopic Mass | 468.39673 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H52O2/c1-20(2)22-12-15-29(6)18-19-31(8)23(27(22)29)10-11-25-30(7)16-14-26(34-21(3)33)28(4,5)24(30)13-17-32(25,31)9/h22-27H,1,10-19H2,2-9H3/t22-,23+,24-,25+,26-,27+,29+,30-,31+,32+/m0/s1 |
| InChIKey | ODSSDTBFHAYYMD-YOJQYFTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lupeol acetate (CHEBI:69744) has role metabolite (CHEBI:25212) |
| lupeol acetate (CHEBI:69744) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 3-Acetyllupeol | KEGG COMPOUND |
| (3beta)-Lup-20(29)-en-3-yl acetate | ChEBI |
| Lupeol acetate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 0001617681 | ChemIDplus |
| C00003750 | KNApSAcK |
| C08630 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1617-68-1 | KEGG COMPOUND |
| Citations |
|---|