EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H34O10 |
| Net Charge | 0 |
| Average Mass | 674.702 |
| Monoisotopic Mass | 674.21520 |
| SMILES | CC(C)=CCc1cc(-c2coc3c(C(C=C(C)C)c4cc(-c5coc6cc(O)cc(O)c6c5=O)ccc4O)c(O)cc(O)c3c2=O)ccc1O |
| InChI | InChI=1S/C40H34O10/c1-19(2)5-6-23-12-21(7-9-29(23)42)28-18-50-40-35(32(45)16-33(46)37(40)39(28)48)26(11-20(3)4)25-13-22(8-10-30(25)43)27-17-49-34-15-24(41)14-31(44)36(34)38(27)47/h5,7-18,26,41-46H,6H2,1-4H3 |
| InChIKey | HCKWMBTVENMFOU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mucusisoflavone C (CHEBI:69743) has role plant metabolite (CHEBI:76924) |
| mucusisoflavone C (CHEBI:69743) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| 8-{1-[5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-3-yl)-2-hydroxyphenyl]-3-methylbut-2-en-1-yl}-5,7-dihydroxy-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 8-[1-[5-(5,7-dihydroxy-4-oxochromen-3-yl)-2-hydroxyphenyl]-3-methylbut-2-enyl]-5,7-dihydroxy-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646914 | Reaxys |
| Citations |
|---|