EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H32O10 |
| Net Charge | 0 |
| Average Mass | 672.686 |
| Monoisotopic Mass | 672.19955 |
| SMILES | CC(C)=C[C@@H]1C[C@](C)(/C=C/c2cc(-c3coc4cc(O)cc(O)c4c3=O)ccc2O)Oc2ccc(-c3coc4cc(O)cc(O)c4c3=O)cc21 |
| InChI | InChI=1S/C40H32O10/c1-20(2)10-24-17-40(3,50-33-7-5-22(12-27(24)33)29-19-49-35-16-26(42)14-32(45)37(35)39(29)47)9-8-23-11-21(4-6-30(23)43)28-18-48-34-15-25(41)13-31(44)36(34)38(28)46/h4-16,18-19,24,41-45H,17H2,1-3H3/b9-8+/t24-,40+/m1/s1 |
| InChIKey | OPQNVODKGMOOPC-ZJVGCZFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mucusisoflavone B (CHEBI:69742) has role plant metabolite (CHEBI:76924) |
| mucusisoflavone B (CHEBI:69742) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| rel-(2'R,4'S)-2'-{(E)-2-[5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-3-yl)-2-hydroxyphenyl]ethenyl}-5,7-dihydroxy-2'-methyl-4'-(2-methylprop-1-en-1-yl)-3',4'-dihydro-2'H,4H-[3,6'-bi-1-benzopyran]-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646915 | Reaxys |
| Citations |
|---|