EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | CC(=O)NCC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-6-10(14)8-2-4-9(13)5-3-8/h2-5,13H,6H2,1H3,(H,11,12) |
| InChIKey | HBFARTJEFUKQDS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacter ferrugineus (ncbitaxon:83449) | latex (BTO:0000710) | PubMed (21591808) | Previous component: resin; Raw extract of fermented culture supplemented with XAD-16 resin Strain: Cb G35 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(4-Hydroxyphenyl)-2-oxoethyl]acetamide (CHEBI:69737) has role metabolite (CHEBI:25212) |
| N-[2-(4-Hydroxyphenyl)-2-oxoethyl]acetamide (CHEBI:69737) is a acetophenones (CHEBI:22187) |
| Citations |
|---|