EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O5 |
| Net Charge | 0 |
| Average Mass | 432.601 |
| Monoisotopic Mass | 432.28757 |
| SMILES | [H][C@]12O[C@@]1(C(=C)CO)C(=O)C=C1[C@H](OC(=O)C(C)CC(C)CC(C)CC)CC[C@H](C)[C@]12C |
| InChI | InChI=1S/C26H40O5/c1-8-15(2)11-16(3)12-17(4)23(29)30-21-10-9-18(5)25(7)20(21)13-22(28)26(19(6)14-27)24(25)31-26/h13,15-18,21,24,27H,6,8-12,14H2,1-5,7H3/t15?,16?,17?,18-,21+,24+,25+,26-/m0/s1 |
| InChIKey | CVLZBOJHINAXHY-VAXWEKKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Endophytic fungi (ncbitaxon:4751) | - | PubMed (21510613) | Methanolic extract of Camarops like Endophytic fungus isolated from leaves of Alibertia macrophylla Strain: AM 02 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylarenone C, (rel)- (CHEBI:69732) has role metabolite (CHEBI:25212) |
| Xylarenone C, (rel)- (CHEBI:69732) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-(1aR,4R,7S,7aR,7bR)-1a-(3-Hydroxy-1-propen-2-yl)-7,7a-dimethyl-2-oxo-1a,2,4,5,6,7,7a,7b-octahydronaphtho[1,2-b]oxiren-4-yl 2,4,6-trimethyloctanoate | ChEBI |
| Citations |
|---|