EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | [H][C@]12O[C@@]1(C(=C)CO)C(=O)C=C1[C@H](O)CC[C@H](C)[C@]12C |
| InChI | InChI=1S/C15H20O4/c1-8-4-5-11(17)10-6-12(18)15(9(2)7-16)13(19-15)14(8,10)3/h6,8,11,13,16-17H,2,4-5,7H2,1,3H3/t8-,11+,13+,14+,15-/m0/s1 |
| InChIKey | PSGJCHLXOJTCGB-SXHPEXCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Endophytic fungi (ncbitaxon:4751) | - | PubMed (21510613) | Methanolic extract of Camarops like Endophytic fungus isolated from leaves of Alibertia macrophylla Strain: AM 02 |
| Xylaria (ncbitaxon:37991) | - | PubMed (21510613) | Strain: NCY2 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xylarenone A, (rel)- (CHEBI:69731) has role metabolite (CHEBI:25212) |
| xylarenone A, (rel)- (CHEBI:69731) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| rel-(1aR,4R,7S,7aR,7bR)-4-Hydroxy-1a-(3-hydroxy-1-propen-2-yl)-7,7a-dimethyl-4,5,6,7,7a,7b-hexahydronaphtho[1,2-b]oxiren-2(1aH)-one | ChEBI |
| Citations |
|---|