EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46O12 |
| Net Charge | 0 |
| Average Mass | 670.752 |
| Monoisotopic Mass | 670.29893 |
| SMILES | [H][C@@]12[C@@H](OC(=O)c3ccccc3)[C@]3(COC(C)=O)[C@H](OC(C)=O)C[C@]4([H])C(C)(C)[C@]4([H])[C@@]3([H])[C@](C)(OC(C)=O)C(=O)[C@@]1(O)C[C@H](C)[C@@H]2OC(=O)CC |
| InChI | InChI=1S/C36H46O12/c1-9-25(40)46-28-18(2)16-36(43)27(28)30(47-31(41)22-13-11-10-12-14-22)35(17-44-19(3)37)24(45-20(4)38)15-23-26(33(23,6)7)29(35)34(8,32(36)42)48-21(5)39/h10-14,18,23-24,26-30,43H,9,15-17H2,1-8H3/t18-,23-,24+,26-,27+,28-,29-,30+,34-,35+,36+/m0/s1 |
| InChIKey | XCYFSKKZKGHHRG-BZCIOZDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Premyrsinol-3-propanoate-5-benzoate-7,13,17-triacetate (CHEBI:69730) has role metabolite (CHEBI:25212) |
| Premyrsinol-3-propanoate-5-benzoate-7,13,17-triacetate (CHEBI:69730) is a monoterpenoid (CHEBI:25409) |
| Citations |
|---|