EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O6 |
| Net Charge | 0 |
| Average Mass | 552.752 |
| Monoisotopic Mass | 552.34509 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1([H])CC(CO)=C[C@]1([H])[C@]2(O)[C@H](C)[C@@H](OC/C=C\C=C\C=C\CCC)[C@@]2(OC(=O)C(C)C)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C34H48O6/c1-8-9-10-11-12-13-14-15-16-39-30-23(5)33(38)26-17-22(4)28(36)25(26)18-24(20-35)19-27(33)29-32(6,7)34(29,30)40-31(37)21(2)3/h10-15,17,19,21,23,25-27,29-30,35,38H,8-9,16,18,20H2,1-7H3/b11-10+,13-12+,15-14-/t23-,25+,26-,27+,29-,30-,33+,34-/m1/s1 |
| InChIKey | NKOQECBSAYYRBF-NTAHFFFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbia substance SPr 5 (CHEBI:69729) has role metabolite (CHEBI:25212) |
| Euphorbia substance SPr 5 (CHEBI:69729) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|