EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H52O15 |
| Net Charge | 0 |
| Average Mass | 832.896 |
| Monoisotopic Mass | 832.33062 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@@H](OC(=O)c5ccccc5)[C@@]1(OC(C)=O)C[C@@](C)(OC(=O)c1ccccc1)[C@@H]2OC(=O)CC)[C@]3([H])[C@@H](C(C)(C)OC(C)=O)C=C[C@H]4OC(C)=O |
| InChI | InChI=1S/C45H52O15/c1-10-33(50)56-36-34-37(55-26(3)47)44-24-53-43(9,35(44)31(41(6,7)58-27(4)48)21-22-32(44)54-25(2)46)40(57-38(51)29-17-13-11-14-18-29)45(34,59-28(5)49)23-42(36,8)60-39(52)30-19-15-12-16-20-30/h11-22,31-32,34-37,40H,10,23-24H2,1-9H3/t31-,32+,34+,35-,36+,37+,40+,42+,43+,44+,45+/m0/s1 |
| InChIKey | KAOAKQUGRHFFFM-IPTJDTAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proliferin B (CHEBI:69727) has role metabolite (CHEBI:25212) |
| Proliferin B (CHEBI:69727) is a benzoate ester (CHEBI:36054) |
| Citations |
|---|