EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H54O15 |
| Net Charge | 0 |
| Average Mass | 798.879 |
| Monoisotopic Mass | 798.34627 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@@H](OC(=O)c5ccccc5)[C@@]1(OC(C)=O)C[C@@](C)(OC(=O)C(C)C)[C@@H]2OC(=O)CC)[C@]3([H])[C@@H](C(C)(C)OC(C)=O)C=C[C@H]4OC(C)=O |
| InChI | InChI=1S/C42H54O15/c1-12-30(47)53-33-31-34(52-24(5)44)41-21-50-40(11,32(41)28(38(8,9)55-25(6)45)18-19-29(41)51-23(4)43)37(54-36(49)27-16-14-13-15-17-27)42(31,56-26(7)46)20-39(33,10)57-35(48)22(2)3/h13-19,22,28-29,31-34,37H,12,20-21H2,1-11H3/t28-,29+,31+,32-,33+,34+,37+,39+,40+,41+,42+/m0/s1 |
| InChIKey | LOQRPHFDWNYUIW-PPTAVVGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proliferin A (CHEBI:69726) has role metabolite (CHEBI:25212) |
| Proliferin A (CHEBI:69726) is a benzoate ester (CHEBI:36054) |
| Citations |
|---|