EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H46O11 |
| Net Charge | 0 |
| Average Mass | 714.808 |
| Monoisotopic Mass | 714.30401 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@@H](OC(=O)c5ccccc5)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(=O)CC)[C@]3([H])[C@@H](C(=C)C)C=C[C@H]4OC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H46O11/c1-8-31(44)50-33-24(4)21-41(52-26(6)43)32(33)35(48-25(5)42)40-22-47-39(7,38(41)51-37(46)28-17-13-10-14-18-28)34(40)29(23(2)3)19-20-30(40)49-36(45)27-15-11-9-12-16-27/h9-20,24,29-30,32-35,38H,2,8,21-22H2,1,3-7H3/t24-,29+,30+,32+,33-,34-,35+,38+,39+,40+,41+/m0/s1 |
| InChIKey | NSASYCVQYGMNHG-YWVDDHHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorprolitherin C (CHEBI:69723) has role metabolite (CHEBI:25212) |
| Euphorprolitherin C (CHEBI:69723) is a benzoate ester (CHEBI:36054) |
| Citations |
|---|