EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44O11 |
| Net Charge | 0 |
| Average Mass | 652.737 |
| Monoisotopic Mass | 652.28836 |
| SMILES | [H][C@]12[C@@H](OC(=O)CC)[C@@H](C)C[C@]1(OC(C)=O)[C@@H](OC(C)=O)[C@]1(C)OC[C@]3([C@H](OC(=O)c4ccccc4)C=C[C@H](C(=C)C)[C@]31[H])[C@H]2OC(C)=O |
| InChI | InChI=1S/C36H44O11/c1-9-27(40)46-29-20(4)17-36(47-23(7)39)28(29)31(43-21(5)37)35-18-42-34(8,33(36)44-22(6)38)30(35)25(19(2)3)15-16-26(35)45-32(41)24-13-11-10-12-14-24/h10-16,20,25-26,28-31,33H,2,9,17-18H2,1,3-8H3/t20-,25+,26+,28+,29-,30-,31-,33-,34+,35+,36+/m0/s1 |
| InChIKey | HUVLAOORYMIHTC-OBKKVEPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-deoxo-3-O-propionyl-5,15-di-O-acetyl-7-O-benzoylmyrsinol-14beta-acetate (CHEBI:69722) has role metabolite (CHEBI:25212) |
| 14-deoxo-3-O-propionyl-5,15-di-O-acetyl-7-O-benzoylmyrsinol-14beta-acetate (CHEBI:69722) is a benzoate ester (CHEBI:36054) |
| Citations |
|---|