EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H44O11 |
| Net Charge | 0 |
| Average Mass | 700.781 |
| Monoisotopic Mass | 700.28836 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@H](OC(=O)c5ccccc5)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(C)=O)[C@]3([H])[C@@H](C(=C)C)C=C[C@H]4OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H44O11/c1-22(2)29-18-19-30(49-35(44)27-14-10-8-11-15-27)39-21-46-38(7,33(29)39)37(50-36(45)28-16-12-9-13-17-28)40(51-26(6)43)20-23(3)32(47-24(4)41)31(40)34(39)48-25(5)42/h8-19,23,29-34,37H,1,20-21H2,2-7H3/t23-,29+,30+,31+,32-,33-,34+,37-,38+,39+,40+/m0/s1 |
| InChIKey | FEESWVAHLOUZGM-LDFAREHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbiaproliferin H (CHEBI:69719) has role metabolite (CHEBI:25212) |
| Euphorbiaproliferin H (CHEBI:69719) is a benzoate ester (CHEBI:36054) |
| Synonym | Source |
|---|---|
| 3beta,5alpha,15beta-tri-O-acetyl-7beta,14beta-di-O-benzoyl-14-deoxomyrsinol | ChEBI |
| Citations |
|---|