EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O11 |
| Net Charge | 0 |
| Average Mass | 590.666 |
| Monoisotopic Mass | 590.27271 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@H](OC(C)=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(=O)CC)[C@]3([H])[C@@H](C(=C)C)C=C[C@H]4OC(C)=O |
| InChI | InChI=1S/C31H42O11/c1-10-23(36)41-25-16(4)13-31(42-20(8)35)24(25)27(39-18(6)33)30-14-37-29(9,28(31)40-19(7)34)26(30)21(15(2)3)11-12-22(30)38-17(5)32/h11-12,16,21-22,24-28H,2,10,13-14H2,1,3-9H3/t16-,21+,22+,24+,25-,26-,27+,28-,29+,30+,31+/m0/s1 |
| InChIKey | KQHUWYDTRJJUNN-PMGAOPNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbiaproliferin G (CHEBI:69718) has role metabolite (CHEBI:25212) |
| Euphorbiaproliferin G (CHEBI:69718) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| 3beta-O-propionyl-5alpha,7beta,14beta,15beta-tetra-O-acetyl-14-deoxomyrsinol | ChEBI |
| Citations |
|---|