EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44O12 |
| Net Charge | 0 |
| Average Mass | 668.736 |
| Monoisotopic Mass | 668.28328 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@H](OC(=O)c5ccccc5)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(=O)CC)[C@]3([H])[C@@H](C(C)(C)OC(C)=O)C=CC4=O |
| InChI | InChI=1S/C36H44O12/c1-9-26(41)45-28-19(2)17-36(48-22(5)39)27(28)30(44-20(3)37)35-18-43-34(8,32(36)46-31(42)23-13-11-10-12-14-23)29(35)24(15-16-25(35)40)33(6,7)47-21(4)38/h10-16,19,24,27-30,32H,9,17-18H2,1-8H3/t19-,24-,27+,28-,29-,30+,32-,34+,35+,36+/m0/s1 |
| InChIKey | SRKVJOIQCZXSCT-PQTFDODOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbiaproliferin D (CHEBI:69715) has role metabolite (CHEBI:25212) |
| Euphorbiaproliferin D (CHEBI:69715) is a benzoate ester (CHEBI:36054) |
| Synonym | Source |
|---|---|
| 3beta-O-propionyl-5alpha,10,15beta-tri-O-acetyl-7-oxo-14beta-O-benzoyl-10,18-dihydromyrsinol | ChEBI |
| Citations |
|---|