EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44O12 |
| Net Charge | 0 |
| Average Mass | 620.692 |
| Monoisotopic Mass | 620.28328 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@H](OC(C)=O)[C@@]1(OC(C)=O)C[C@H](C)[C@@H]2OC(=O)C(C)C)[C@]3([H])[C@@H](C(C)(C)OC(C)=O)C=CC4=O |
| InChI | InChI=1S/C32H44O12/c1-15(2)27(38)42-24-16(3)13-32(44-20(7)36)23(24)26(40-17(4)33)31-14-39-30(10,28(32)41-18(5)34)25(31)21(11-12-22(31)37)29(8,9)43-19(6)35/h11-12,15-16,21,23-26,28H,13-14H2,1-10H3/t16-,21-,23+,24-,25-,26+,28-,30+,31+,32+/m0/s1 |
| InChIKey | MEMULCZBXUZFOZ-XBPHKDPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbiaproliferin C (CHEBI:69714) has role metabolite (CHEBI:25212) |
| Euphorbiaproliferin C (CHEBI:69714) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| 3beta-O-isobutyryl-5alpha,10,14beta,15beta-tetra-O-acetyl-7-oxo-10,18-dihydromyrsinol | ChEBI |
| Citations |
|---|