EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H54O15 |
| Net Charge | 0 |
| Average Mass | 846.923 |
| Monoisotopic Mass | 846.34627 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@@H](OC(=O)c5ccccc5)[C@@]1(OC(C)=O)C[C@@](C)(OC(=O)c1ccccc1)[C@@H]2OC(=O)CCC)[C@]3([H])[C@@H](C(C)(C)OC(C)=O)C=C[C@H]4OC(C)=O |
| InChI | InChI=1S/C46H54O15/c1-10-17-34(51)57-37-35-38(56-27(3)48)45-25-54-44(9,36(45)32(42(6,7)59-28(4)49)22-23-33(45)55-26(2)47)41(58-39(52)30-18-13-11-14-19-30)46(35,60-29(5)50)24-43(37,8)61-40(53)31-20-15-12-16-21-31/h11-16,18-23,32-33,35-38,41H,10,17,24-25H2,1-9H3/t32-,33+,35+,36-,37+,38+,41+,43+,44+,45+,46+/m0/s1 |
| InChIKey | GLKWKFVTWFLQRO-NGGQJPHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbiaproliferin B, (rel)- (CHEBI:69713) has role metabolite (CHEBI:25212) |
| Euphorbiaproliferin B, (rel)- (CHEBI:69713) is a benzoate ester (CHEBI:36054) |
| Euphorbiaproliferin B, (rel)- (CHEBI:69713) is a butyrate ester (CHEBI:50477) |
| Synonym | Source |
|---|---|
| rel-2alpha,14alpha-di-O-benzoyl-3beta-O-butyryl-5alpha,7beta,10,15beta-tetra-O-acetyl-10,18-dihydromyrsinol | ChEBI |
| Citations |
|---|