EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H56O15 |
| Net Charge | 0 |
| Average Mass | 764.862 |
| Monoisotopic Mass | 764.36192 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34CO[C@@](C)([C@@H](OC(=O)C(C)C)[C@@]1(OC(C)=O)C[C@@](C)(OC(=O)C(C)C)[C@@H]2OC(=O)CC)[C@]3([H])[C@@H](C(C)(C)OC(C)=O)C=C[C@H]4OC(C)=O |
| InChI | InChI=1S/C39H56O15/c1-14-27(44)50-30-28-31(49-22(7)41)38-18-47-37(13,29(38)25(35(10,11)52-23(8)42)15-16-26(38)48-21(6)40)34(51-32(45)19(2)3)39(28,53-24(9)43)17-36(30,12)54-33(46)20(4)5/h15-16,19-20,25-26,28-31,34H,14,17-18H2,1-13H3/t25-,26+,28+,29-,30+,31+,34+,36+,37+,38+,39+/m0/s1 |
| InChIKey | SKVOKCRGVKYGQI-RHCYJGMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia prolifera (IPNI:347888-1) | root (BTO:0001188) | PubMed (21928782) | Ethyl acetate soluble part of methanol extract of air-dried roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphorbiaproliferin A, (rel)- (CHEBI:69712) has role metabolite (CHEBI:25212) |
| Euphorbiaproliferin A, (rel)- (CHEBI:69712) is a carbonyl compound (CHEBI:36586) |
| Synonym | Source |
|---|---|
| rel-2alpha,14alpha-di-O-isobutyryl-3beta-O-propionyl-5alpha,7beta,10,15beta-tetra-O-acetyl-10,18-dihydromyrsinol | ChEBI |
| Citations |
|---|