EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | OC[C@@H]1COC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C10H11NO3/c12-5-7-6-14-10(11-7)8-3-1-2-4-9(8)13/h1-4,7,12-13H,5-6H2/t7-/m1/s1 |
| InChIKey | KSWPNAGSVMAXMO-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis dassonvillei (ncbitaxon:2014) | spore (BTO:0001171) | PubMed (21958359) | Ethylacetate extract of fermentation medium inoculated with spores Strain: HR10 5 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocazoline A (CHEBI:69711) has role metabolite (CHEBI:25212) |
| Nocazoline A (CHEBI:69711) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| (R)-2-(2-hydroxyphenyl)-4-hydroxymethyl-4,5-dihydrooxazole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26636558 | ChemSpider |
| Citations |
|---|