EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N2O3 |
| Net Charge | 0 |
| Average Mass | 348.402 |
| Monoisotopic Mass | 348.14739 |
| SMILES | COc1ccc(/C=c2/c(OC)n/c(=C\c3ccccc3)c(=O)n2C)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-23-19(14-16-9-11-17(25-2)12-10-16)20(26-3)22-18(21(23)24)13-15-7-5-4-6-8-15/h4-14H,1-3H3/b18-13-,19-14- |
| InChIKey | NCBOROGHSUXZPE-SXQSXHJWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis dassonvillei (ncbitaxon:2014) | spore (BTO:0001171) | PubMed (21958359) | Ethylacetate extract of fermentation medium inoculated with spores Strain: HR10 5 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocazine B (CHEBI:69709) has role metabolite (CHEBI:25212) |
| Nocazine B (CHEBI:69709) is a aromatic ether (CHEBI:35618) |
| Nocazine B (CHEBI:69709) is a pyrazines (CHEBI:38314) |
| Synonym | Source |
|---|---|
| (3Z,6Z)-3-benzylidene-5-methoxy-6-(4-methoxybenzylidene)-1-methyl-1,6-dihydropyrazin-2(3H)-one | ChEBI |
| Citations |
|---|