EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O4 |
| Net Charge | 0 |
| Average Mass | 378.428 |
| Monoisotopic Mass | 378.15796 |
| SMILES | COc1ccc(/C=c2\nc(OC)/c(=C/c3ccc(OC)cc3)n(C)c2=O)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-24-20(14-16-7-11-18(27-3)12-8-16)21(28-4)23-19(22(24)25)13-15-5-9-17(26-2)10-6-15/h5-14H,1-4H3/b19-13-,20-14- |
| InChIKey | PIZYGUXDBZYKHO-AXPXABNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis dassonvillei (ncbitaxon:2014) | spore (BTO:0001171) | PubMed (21958359) | Ethylacetate extract of fermentation medium inoculated with spores Strain: HR10 5 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocazine A (CHEBI:69708) has role metabolite (CHEBI:25212) |
| Nocazine A (CHEBI:69708) is a aromatic ether (CHEBI:35618) |
| Nocazine A (CHEBI:69708) is a pyrazines (CHEBI:38314) |
| Synonym | Source |
|---|---|
| (3Z,6Z)-5-methoxy-3,6-bis(4-methoxybenzylidene)-1-methyl-1,6-dihydropyrazin-2(3H)-one | ChEBI |
| Citations |
|---|