EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | CCc1ccc(/C(C)=C/[C@H](C)O)oc1=O |
| InChI | InChI=1S/C12H16O3/c1-4-10-5-6-11(15-12(10)14)8(2)7-9(3)13/h5-7,9,13H,4H2,1-3H3/b8-7+/t9-/m0/s1 |
| InChIKey | GCFLNLMFXNZUSH-FLOXNTQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis dassonvillei (ncbitaxon:2014) | spore (BTO:0001171) | PubMed (21958359) | Ethylacetate extract of fermentation medium inoculated with spores Strain: HR10 5 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocapyrone G (CHEBI:69707) has role metabolite (CHEBI:25212) |
| Nocapyrone G (CHEBI:69707) is a 2-pyranones (CHEBI:75885) |
| Synonym | Source |
|---|---|
| (S,E)-3-ethyl-6-(4-hydroxypent-2-en-2-yl)-2H-pyran-2-one | ChEBI |
| Citations |
|---|