EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O4 |
| Net Charge | 0 |
| Average Mass | 288.343 |
| Monoisotopic Mass | 288.13616 |
| SMILES | COc1ccc(CCCc2ccc(O)c(OC)c2)c(O)c1 |
| InChI | InChI=1S/C17H20O4/c1-20-14-8-7-13(16(19)11-14)5-3-4-12-6-9-15(18)17(10-12)21-2/h6-11,18-19H,3-5H2,1-2H3 |
| InChIKey | UDWSABBWZXKLLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum griffithii (IPNI:170132-1) | stem (BTO:0001300) | PubMed (21919533) | Methanol extract of air-dried stems. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role antimycobacterial drug (CHEBI:64912) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role antineoplastic agent (CHEBI:35610) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role metabolite (CHEBI:25212) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role plant metabolite (CHEBI:76924) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| 4-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6521737 | Reaxys |
| Citations |
|---|