EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O4 |
| Net Charge | 0 |
| Average Mass | 288.343 |
| Monoisotopic Mass | 288.13616 |
| SMILES | COc1ccc(CCCc2ccc(O)c(OC)c2)c(O)c1 |
| InChI | InChI=1S/C17H20O4/c1-20-14-8-7-13(16(19)11-14)5-3-4-12-6-9-15(18)17(10-12)21-2/h6-11,18-19H,3-5H2,1-2H3 |
| InChIKey | UDWSABBWZXKLLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum griffithii (IPNI:170132-1) | stem (BTO:0001300) | PubMed (21919533) | Methanol extract of air-dried stems. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Applications: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role antimycobacterial drug (CHEBI:64912) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role antineoplastic agent (CHEBI:35610) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role metabolite (CHEBI:25212) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) has role plant metabolite (CHEBI:76924) |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane (CHEBI:69704) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| 4-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6521737 | Reaxys |
| Citations |
|---|