EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COC1=CC(=O)C(CCCc2ccc(O)c(OC)c2)=CC1=O |
| InChI | InChI=1S/C17H18O5/c1-21-16-8-11(6-7-13(16)18)4-3-5-12-9-15(20)17(22-2)10-14(12)19/h6-10,18H,3-5H2,1-2H3 |
| InChIKey | QMDYKPDQQKWJLM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum griffithii (IPNI:170132-1) | stem (BTO:0001300) | PubMed (21919533) | Methanol extract of air-dried stems. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| griffithane D (CHEBI:69703) has role antineoplastic agent (CHEBI:35610) |
| griffithane D (CHEBI:69703) has role metabolite (CHEBI:25212) |
| griffithane D (CHEBI:69703) has role plant metabolite (CHEBI:76924) |
| griffithane D (CHEBI:69703) is a 1,4-benzoquinones (CHEBI:132124) |
| griffithane D (CHEBI:69703) is a monomethoxybenzene (CHEBI:25235) |
| griffithane D (CHEBI:69703) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-[3-(4-hydroxy-3-methoxyphenyl)propyl]-5-methoxycyclohexa-2,5-diene-1,4-dione |
| Citations |
|---|