EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O5 |
| Net Charge | 0 |
| Average Mass | 318.369 |
| Monoisotopic Mass | 318.14672 |
| SMILES | COc1cc(CCCc2cc(OC)c(O)cc2OC)ccc1O |
| InChI | InChI=1S/C18H22O5/c1-21-16-11-15(20)18(23-3)10-13(16)6-4-5-12-7-8-14(19)17(9-12)22-2/h7-11,19-20H,4-6H2,1-3H3 |
| InChIKey | DNCLFIXPFOHTLG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum griffithii (IPNI:170132-1) | stem (BTO:0001300) | PubMed (21919533) | Methanol extract of air-dried stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| griffithane A (CHEBI:69700) has role antineoplastic agent (CHEBI:35610) |
| griffithane A (CHEBI:69700) has role plant metabolite (CHEBI:76924) |
| griffithane A (CHEBI:69700) is a dimethoxybenzene (CHEBI:51681) |
| griffithane A (CHEBI:69700) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4-[3-(4-hydroxy-3-methoxyphenyl)propyl]-2,5-dimethoxyphenol |
| Synonym | Source |
|---|---|
| 1-(4-hydroxy-2,5-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21975539 | Reaxys |
| Citations |
|---|