EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24O6 |
| Net Charge | 0 |
| Average Mass | 408.450 |
| Monoisotopic Mass | 408.15729 |
| SMILES | C[C@H]1O[C@@]2(C=Cc3cccc(O)c3CO2)[C@@H](C)O[C@@]12C=Cc1cccc(O)c1CO2 |
| InChI | InChI=1S/C24H24O6/c1-15-23(11-9-17-5-3-7-21(25)19(17)13-27-23)30-16(2)24(29-15)12-10-18-6-4-8-22(26)20(18)14-28-24/h3-12,15-16,25-26H,13-14H2,1-2H3/t15-,16-,23+,24+/m1/s1 |
| InChIKey | GWADQOOKXMSEMY-ICQFYHOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis virgatula (ncbitaxon:290289) | mycelium (BTO:0001436) | PubMed (21942847) | Endophytic fungus derived from the plant Terminalia chebula. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestalospirane B (CHEBI:69699) has role metabolite (CHEBI:25212) |
| Pestalospirane B (CHEBI:69699) is a phenols (CHEBI:33853) |
| Citations |
|---|