EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O4 |
| Net Charge | 0 |
| Average Mass | 220.224 |
| Monoisotopic Mass | 220.07356 |
| SMILES | CC1(O)C(=O)C=Cc2c1ccc(O)c2CO |
| InChI | InChI=1S/C12H12O4/c1-12(16)9-3-4-10(14)8(6-13)7(9)2-5-11(12)15/h2-5,13-14,16H,6H2,1H3 |
| InChIKey | YFFBGKSSWQKSMK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis virgatula (ncbitaxon:290289) | mycelium (BTO:0001436) | PubMed (21942847) | Endophytic fungus derived from the plant Terminalia chebula. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclosordariolone, (rac)- (CHEBI:69693) has role metabolite (CHEBI:25212) |
| Cyclosordariolone, (rac)- (CHEBI:69693) is a naphthols (CHEBI:25392) |
| Synonym | Source |
|---|---|
| rac-1,6-Dihydroxy-5-(hydroxymethyl)-1-methylnaphthalen-2(1H)-one | ChEBI |
| Citations |
|---|