EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O4 |
| Net Charge | 0 |
| Average Mass | 464.646 |
| Monoisotopic Mass | 464.29266 |
| SMILES | [H][C@@]12C[C@]3([H])C(C)=CC(=O)[C@@]45CC[C@]6([H])C(C)(C)CCC[C@@]67C[C@]43[C@]1(O7)C(=C(C(C)C)C5=O)OC2(C)C |
| InChI | InChI=1S/C30H40O4/c1-16(2)22-23(32)28-12-9-19-25(4,5)10-8-11-27(19)15-29(28)18(17(3)13-21(28)31)14-20-26(6,7)33-24(22)30(20,29)34-27/h13,16,18-20H,8-12,14-15H2,1-7H3/t18-,19-,20+,27-,28-,29-,30-/m1/s1 |
| InChIKey | HBIBHELUGMKMMU-GHDDMMGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia hydrangea (ncbitaxon:392666) | aerial part (BTO:0001658) | PubMed (21967089) | n-Hexane extract of air-dried, powdered aerial parts. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Perovskone B (CHEBI:69691) has role metabolite (CHEBI:25212) |
| Perovskone B (CHEBI:69691) is a sesterterpenoid (CHEBI:26660) |
| Citations |
|---|